C15H29N3O4 — CID 158672651
4-(3-amino-3-iminopropyl)piperidine-1-carboxylic acid;tert-butyl acetate (PubChem CID 158672651) has the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. Its IUPAC name is 4-(3-amino-3-iminopropyl)piperidine-1-carboxylic acid;tert-butyl acetate.
| Compound Name | 4-(3-amino-3-iminopropyl)piperidine-1-carboxylic acid;tert-butyl acetate |
|---|---|
| PubChem CID | 158672651 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 4-(3-amino-3-iminopropyl)piperidine-1-carboxylic acid;tert-butyl acetate |
| SMILES | CC(=O)OC(C)(C)C.[H]/N=C(\N)CCC1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C9H17N3O2.C6H12O2/c10-8(11)2-1-7-3-5-12(6-4-7)9(13)14;1-5(7)8-6(2,3)4/h7H,1-6H2,(H3,10,11)(H,13,14);1-4H3 |
| InChIKey | IEDFSEGUULUBRM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|