C9H19N5 — CID 142657807
4-(3-amino-3-iminopropyl)piperidine-1-carboximidamide (PubChem CID 142657807) has the molecular formula C9H19N5 and a molecular weight of 197.29 g/mol. Its IUPAC name is 4-(3-amino-3-iminopropyl)piperidine-1-carboximidamide.
| Compound Name | 4-(3-amino-3-iminopropyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 142657807 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 4-(3-amino-3-iminopropyl)piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)CCC1CCN(/C(N)=N/[H])CC1 |
| InChI | InChI=1S/C9H19N5/c10-8(11)2-1-7-3-5-14(6-4-7)9(12)13/h7H,1-6H2,(H3,10,11)(H3,12,13) |
| InChIKey | JZPARDZWMGTNST-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|