C16H20N4O2 — CID 13188154
(4-cyanophenyl) 3-(1-carbamimidoylpiperidin-4-yl)propanoate (PubChem CID 13188154) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (4-cyanophenyl) 3-(1-carbamimidoylpiperidin-4-yl)propanoate.
| Compound Name | (4-cyanophenyl) 3-(1-carbamimidoylpiperidin-4-yl)propanoate |
|---|---|
| PubChem CID | 13188154 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (4-cyanophenyl) 3-(1-carbamimidoylpiperidin-4-yl)propanoate |
| SMILES | [H]/N=C(\N)N1CCC(CCC(=O)Oc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C16H20N4O2/c17-11-13-1-4-14(5-2-13)22-15(21)6-3-12-7-9-20(10-8-12)16(18)19/h1-2,4-5,12H,3,6-10H2,(H3,18,19) |
| InChIKey | CQNHPAJRGRPFJU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|