C23H29ClN2O2 — CID 139645049
(4-benzylphenyl) 3-(4-carbamimidoylcyclohexyl)propanoate;hydrochloride (PubChem CID 139645049) has the molecular formula C23H29ClN2O2 and a molecular weight of 400.95 g/mol. Its IUPAC name is (4-benzylphenyl) 3-(4-carbamimidoylcyclohexyl)propanoate;hydrochloride.
| Compound Name | (4-benzylphenyl) 3-(4-carbamimidoylcyclohexyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 139645049 |
| Molecular Formula | C23H29ClN2O2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (4-benzylphenyl) 3-(4-carbamimidoylcyclohexyl)propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C1CCC(CCC(=O)Oc2ccc(Cc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H28N2O2.ClH/c24-23(25)20-11-6-17(7-12-20)10-15-22(26)27-21-13-8-19(9-14-21)16-18-4-2-1-3-5-18;/h1-5,8-9,13-14,17,20H,6-7,10-12,15-16H2,(H3,24,25);1H |
| InChIKey | CKIOVUVYSBBYIK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|