C19H26O4 — CID 171426105
[4-(3-cyclopentylpropanoyloxy)phenyl]methyl 2-methylpropanoate (PubChem CID 171426105) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is [4-(3-cyclopentylpropanoyloxy)phenyl]methyl 2-methylpropanoate.
| Compound Name | [4-(3-cyclopentylpropanoyloxy)phenyl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 171426105 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [4-(3-cyclopentylpropanoyloxy)phenyl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCc1ccc(OC(=O)CCC2CCCC2)cc1 |
| InChI | InChI=1S/C19H26O4/c1-14(2)19(21)22-13-16-7-10-17(11-8-16)23-18(20)12-9-15-5-3-4-6-15/h7-8,10-11,14-15H,3-6,9,12-13H2,1-2H3 |
| InChIKey | XGLCIOKHJCYRMQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|