C23H27NO3 — CID 60594598
[4-[methyl-(4-methylbenzoyl)amino]phenyl] 3-cyclopentylpropanoate (PubChem CID 60594598) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is [4-[methyl-(4-methylbenzoyl)amino]phenyl] 3-cyclopentylpropanoate.
| Compound Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 60594598 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 3-cyclopentylpropanoate |
| SMILES | Cc1ccc(C(=O)N(C)c2ccc(OC(=O)CCC3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C23H27NO3/c1-17-7-10-19(11-8-17)23(26)24(2)20-12-14-21(15-13-20)27-22(25)16-9-18-5-3-4-6-18/h7-8,10-15,18H,3-6,9,16H2,1-2H3 |
| InChIKey | LSCTYCZFVSWIRD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|