C22H23NO3 — CID 60594523
[4-[methyl-(4-methylbenzoyl)amino]phenyl] cyclohex-3-ene-1-carboxylate (PubChem CID 60594523) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is [4-[methyl-(4-methylbenzoyl)amino]phenyl] cyclohex-3-ene-1-carboxylate.
| Compound Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 60594523 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] cyclohex-3-ene-1-carboxylate |
| SMILES | Cc1ccc(C(=O)N(C)c2ccc(OC(=O)C3CC=CCC3)cc2)cc1 |
| InChI | InChI=1S/C22H23NO3/c1-16-8-10-17(11-9-16)21(24)23(2)19-12-14-20(15-13-19)26-22(25)18-6-4-3-5-7-18/h3-4,8-15,18H,5-7H2,1-2H3 |
| InChIKey | FSCPXXKFKSGLFH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|