C25H22N2O4 — CID 55507548
[4-[methyl-(4-methylbenzoyl)amino]phenyl] 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate (PubChem CID 55507548) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is [4-[methyl-(4-methylbenzoyl)amino]phenyl] 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate.
| Compound Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 55507548 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate |
| SMILES | Cc1ccc(C(=O)N(C)c2ccc(OC(=O)C3CC(=O)Nc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C25H22N2O4/c1-16-7-9-17(10-8-16)24(29)27(2)18-11-13-19(14-12-18)31-25(30)21-15-23(28)26-22-6-4-3-5-20(21)22/h3-14,21H,15H2,1-2H3,(H,26,28) |
| InChIKey | JZHFZSHLAJFRTM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|