C15H14FNO — CID 90825251
N-(4-fluorophenyl)-N,4-dimethylbenzamide (PubChem CID 90825251) has the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N,4-dimethylbenzamide.
| Compound Name | N-(4-fluorophenyl)-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 90825251 |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-(4-fluorophenyl)-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C15H14FNO/c1-11-3-5-12(6-4-11)15(18)17(2)14-9-7-13(16)8-10-14/h3-10H,1-2H3 |
| InChIKey | GJBVGKOVEMVXSZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |