C14H12FNO3 — CID 103956579
N-(4-fluorophenyl)-3,4-dihydroxy-N-methylbenzamide (PubChem CID 103956579) has the molecular formula C14H12FNO3 and a molecular weight of 261.25 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3,4-dihydroxy-N-methylbenzamide.
| Compound Name | N-(4-fluorophenyl)-3,4-dihydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 103956579 |
| Molecular Formula | C14H12FNO3 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-(4-fluorophenyl)-3,4-dihydroxy-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(O)c(O)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H12FNO3/c1-16(11-5-3-10(15)4-6-11)14(19)9-2-7-12(17)13(18)8-9/h2-8,17-18H,1H3 |
| InChIKey | NEUMNSTVPPGXNO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|