C16H17NO3 — CID 107728488
N-(4-ethylphenyl)-3,4-dihydroxy-N-methylbenzamide (PubChem CID 107728488) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3,4-dihydroxy-N-methylbenzamide.
| Compound Name | N-(4-ethylphenyl)-3,4-dihydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 107728488 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-(4-ethylphenyl)-3,4-dihydroxy-N-methylbenzamide |
| SMILES | CCc1ccc(N(C)C(=O)c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C16H17NO3/c1-3-11-4-7-13(8-5-11)17(2)16(20)12-6-9-14(18)15(19)10-12/h4-10,18-19H,3H2,1-2H3 |
| InChIKey | UBPZUSMWHSPZPT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|