About (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate
(4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate (PubChem CID 24603462) has the molecular formula C23H19NO3
and a molecular weight of 357.41 g/mol. Its IUPAC name is (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate.
Molecular Properties
| Compound Name | (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate |
| PubChem CID | 24603462 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate |
| SMILES | O=C1CC(C(=O)OCc2ccc(-c3ccccc3)cc2)c2ccccc2N1 |
| InChI | InChI=1S/C23H19NO3/c25-22-14-20(19-8-4-5-9-21(19)24-22)23(26)27-15-16-10-12-18(13-11-16)17-6-2-1-3-7-17/h1-13,20H,14-15H2,(H,24,25) |
| InChIKey | VDSAOTYHVBZPRO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate?
The IUPAC name of (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate (CID 24603462) is (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate.
What is the SMILES notation for (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate?
The canonical SMILES for (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate is O=C1CC(C(=O)OCc2ccc(-c3ccccc3)cc2)c2ccccc2N1.
What is the InChIKey of (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate?
The InChIKey is VDSAOTYHVBZPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO3/c25-22-14-20(19-8-4-5-9-21(19)24-22)23(26)27-15-16-10-12-18(13-11-16)17-6-2-1-3-7-17/h1-13,20H,14-15H2,(H,24,25).
What are the key properties of (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate?
(4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate has a molecular weight of 357.41 g/mol, XLogP of 4.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylphenyl)methyl 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylate is sourced from PubChem (CID 24603462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).