C26H23ClN2O4 — CID 55583631
[4-[methyl-(4-methylbenzoyl)amino]phenyl] 1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 55583631) has the molecular formula C26H23ClN2O4 and a molecular weight of 462.93 g/mol. Its IUPAC name is [4-[methyl-(4-methylbenzoyl)amino]phenyl] 1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 55583631 |
| Molecular Formula | C26H23ClN2O4 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(C(=O)N(C)c2ccc(OC(=O)C3CC(=O)N(c4cccc(Cl)c4)C3)cc2)cc1 |
| InChI | InChI=1S/C26H23ClN2O4/c1-17-6-8-18(9-7-17)25(31)28(2)21-10-12-23(13-11-21)33-26(32)19-14-24(30)29(16-19)22-5-3-4-20(27)15-22/h3-13,15,19H,14,16H2,1-2H3 |
| InChIKey | DJQGFFZMFFEVRF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|