C26H26N2O4S — CID 33188030
[4-[methyl-(4-methylbenzoyl)amino]phenyl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate (PubChem CID 33188030) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is [4-[methyl-(4-methylbenzoyl)amino]phenyl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate.
| Compound Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 33188030 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [4-[methyl-(4-methylbenzoyl)amino]phenyl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate |
| SMILES | Cc1ccc(C(=O)N(C)c2ccc(OC(=O)C3CCN(C(=O)c4cccs4)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H26N2O4S/c1-18-5-7-19(8-6-18)24(29)27(2)21-9-11-22(12-10-21)32-26(31)20-13-15-28(16-14-20)25(30)23-4-3-17-33-23/h3-12,17,20H,13-16H2,1-2H3 |
| InChIKey | QNZKDLBGYRHRFJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|