C15H22ClN3O2 — CID 70508389
phenyl 3-(1-carbamimidoylpiperidin-4-yl)propanoate;hydrochloride (PubChem CID 70508389) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is phenyl 3-(1-carbamimidoylpiperidin-4-yl)propanoate;hydrochloride.
| Compound Name | phenyl 3-(1-carbamimidoylpiperidin-4-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 70508389 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | phenyl 3-(1-carbamimidoylpiperidin-4-yl)propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCC(CCC(=O)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C15H21N3O2.ClH/c16-15(17)18-10-8-12(9-11-18)6-7-14(19)20-13-4-2-1-3-5-13;/h1-5,12H,6-11H2,(H3,16,17);1H |
| InChIKey | URXANSQPPFZIJY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|