C19H28ClN3O3 — CID 13289619
(2-methoxy-4-prop-2-enylphenyl) 3-(1-carbamimidoylpiperidin-4-yl)propanoate;hydrochloride (PubChem CID 13289619) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is (2-methoxy-4-prop-2-enylphenyl) 3-(1-carbamimidoylpiperidin-4-yl)propanoate;hydrochloride.
| Compound Name | (2-methoxy-4-prop-2-enylphenyl) 3-(1-carbamimidoylpiperidin-4-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 13289619 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (2-methoxy-4-prop-2-enylphenyl) 3-(1-carbamimidoylpiperidin-4-yl)propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCC(CCC(=O)Oc2ccc(CC=C)cc2OC)CC1 |
| InChI | InChI=1S/C19H27N3O3.ClH/c1-3-4-15-5-7-16(17(13-15)24-2)25-18(23)8-6-14-9-11-22(12-10-14)19(20)21;/h3,5,7,13-14H,1,4,6,8-12H2,2H3,(H3,20,21);1H |
| InChIKey | KTBXGDOESIUZJT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|