C17H25N3O2 — CID 15583522
(4-methylphenyl) 4-(1-carbamimidoylpiperidin-4-yl)butanoate (PubChem CID 15583522) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (4-methylphenyl) 4-(1-carbamimidoylpiperidin-4-yl)butanoate.
| Compound Name | (4-methylphenyl) 4-(1-carbamimidoylpiperidin-4-yl)butanoate |
|---|---|
| PubChem CID | 15583522 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (4-methylphenyl) 4-(1-carbamimidoylpiperidin-4-yl)butanoate |
| SMILES | [H]/N=C(\N)N1CCC(CCCC(=O)Oc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-13-5-7-15(8-6-13)22-16(21)4-2-3-14-9-11-20(12-10-14)17(18)19/h5-8,14H,2-4,9-12H2,1H3,(H3,18,19) |
| InChIKey | IHFORTDFUFRYDN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|