About (4-cyanophenyl) 4-bromobutanoate
(4-cyanophenyl) 4-bromobutanoate (PubChem CID 532372) has the molecular formula C11H10BrNO2
and a molecular weight of 268.11 g/mol. Its IUPAC name is (4-cyanophenyl) 4-bromobutanoate.
Molecular Properties
| Compound Name | (4-cyanophenyl) 4-bromobutanoate |
| PubChem CID | 532372 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | (4-cyanophenyl) 4-bromobutanoate |
| SMILES | N#Cc1ccc(OC(=O)CCCBr)cc1 |
| InChI | InChI=1S/C11H10BrNO2/c12-7-1-2-11(14)15-10-5-3-9(8-13)4-6-10/h3-6H,1-2,7H2 |
| InChIKey | GRWOXAONZBZBSY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl) 4-bromobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl) 4-bromobutanoate?
The IUPAC name of (4-cyanophenyl) 4-bromobutanoate (CID 532372) is (4-cyanophenyl) 4-bromobutanoate.
What is the SMILES notation for (4-cyanophenyl) 4-bromobutanoate?
The canonical SMILES for (4-cyanophenyl) 4-bromobutanoate is N#Cc1ccc(OC(=O)CCCBr)cc1.
What is the InChIKey of (4-cyanophenyl) 4-bromobutanoate?
The InChIKey is GRWOXAONZBZBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrNO2/c12-7-1-2-11(14)15-10-5-3-9(8-13)4-6-10/h3-6H,1-2,7H2.
What are the key properties of (4-cyanophenyl) 4-bromobutanoate?
(4-cyanophenyl) 4-bromobutanoate has a molecular weight of 268.11 g/mol, XLogP of 2.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl) 4-bromobutanoate is sourced from PubChem (CID 532372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).