About 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate
4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate (PubChem CID 102484228) has the molecular formula C20H15NO4
and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate |
| PubChem CID | 102484228 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate |
| SMILES | C#CCOC(=O)CCC(=O)Oc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C20H15NO4/c1-2-13-24-19(22)11-12-20(23)25-18-9-7-17(8-10-18)16-5-3-15(14-21)4-6-16/h1,3-10H,11-13H2 |
| InChIKey | OQLLLNAPRXZWQG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate?
The IUPAC name of 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate (CID 102484228) is 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate.
What is the SMILES notation for 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate?
The canonical SMILES for 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate is C#CCOC(=O)CCC(=O)Oc1ccc(-c2ccc(C#N)cc2)cc1.
What is the InChIKey of 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate?
The InChIKey is OQLLLNAPRXZWQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO4/c1-2-13-24-19(22)11-12-20(23)25-18-9-7-17(8-10-18)16-5-3-15(14-21)4-6-16/h1,3-10H,11-13H2.
What are the key properties of 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate?
4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate has a molecular weight of 333.34 g/mol, XLogP of 3.09, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[4-(4-cyanophenyl)phenyl] 1-O-prop-2-ynyl butanedioate is sourced from PubChem (CID 102484228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).