C14H27N3O3Si — CID 149435566
N-[1,2-bis[acetyl(ethyl)amino]-2-silylethenyl]-N-ethylacetamide (PubChem CID 149435566) has the molecular formula C14H27N3O3Si and a molecular weight of 313.47 g/mol. Its IUPAC name is N-[1,2-bis[acetyl(ethyl)amino]-2-silylethenyl]-N-ethylacetamide.
| Compound Name | N-[1,2-bis[acetyl(ethyl)amino]-2-silylethenyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 149435566 |
| Molecular Formula | C14H27N3O3Si |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[1,2-bis[acetyl(ethyl)amino]-2-silylethenyl]-N-ethylacetamide |
| SMILES | CCN(C(C)=O)C([SiH3])=C(N(CC)C(C)=O)N(CC)C(C)=O |
| InChI | InChI=1S/C14H27N3O3Si/c1-7-15(10(4)18)13(16(8-2)11(5)19)14(21)17(9-3)12(6)20/h7-9H2,1-6,21H3 |
| InChIKey | LJDFQIFHBCMDKX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|