C7H16N2O — CID 54380115
N,N'-diethyl-N'-methylacetohydrazide (PubChem CID 54380115) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is N,N'-diethyl-N'-methylacetohydrazide.
| Compound Name | N,N'-diethyl-N'-methylacetohydrazide |
|---|---|
| PubChem CID | 54380115 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | N,N'-diethyl-N'-methylacetohydrazide |
| SMILES | CCN(C)N(CC)C(C)=O |
| InChI | InChI=1S/C7H16N2O/c1-5-8(4)9(6-2)7(3)10/h5-6H2,1-4H3 |
| InChIKey | UZHQHXILGANNJK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|