C14H31NSi — CID 173064653
N,N-diethyl-2,2,5,5-tetramethyl-4-silylhex-3-en-3-amine (PubChem CID 173064653) has the molecular formula C14H31NSi and a molecular weight of 241.49 g/mol. Its IUPAC name is N,N-diethyl-2,2,5,5-tetramethyl-4-silylhex-3-en-3-amine.
| Compound Name | N,N-diethyl-2,2,5,5-tetramethyl-4-silylhex-3-en-3-amine |
|---|---|
| PubChem CID | 173064653 |
| Molecular Formula | C14H31NSi |
| Molecular Weight | 241.49 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | N,N-diethyl-2,2,5,5-tetramethyl-4-silylhex-3-en-3-amine |
| SMILES | CCN(CC)C(=C([SiH3])C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H31NSi/c1-9-15(10-2)11(13(3,4)5)12(16)14(6,7)8/h9-10H2,1-8,16H3 |
| InChIKey | MEGHFJYAFBHEIC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|