C17H31NO3 — CID 91568368
3-(2,2-dimethylpropanoyl)-N,N-diethyl-5,5-dimethyl-4-oxohexanamide (PubChem CID 91568368) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoyl)-N,N-diethyl-5,5-dimethyl-4-oxohexanamide.
| Compound Name | 3-(2,2-dimethylpropanoyl)-N,N-diethyl-5,5-dimethyl-4-oxohexanamide |
|---|---|
| PubChem CID | 91568368 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 3-(2,2-dimethylpropanoyl)-N,N-diethyl-5,5-dimethyl-4-oxohexanamide |
| SMILES | CCN(CC)C(=O)CC(C(=O)C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H31NO3/c1-9-18(10-2)13(19)11-12(14(20)16(3,4)5)15(21)17(6,7)8/h12H,9-11H2,1-8H3 |
| InChIKey | PJGAOCQISHFNLK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|