C8H17NO2 — CID 11542825
(3R)-N,N-diethyl-3-hydroxybutanamide (PubChem CID 11542825) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is (3R)-N,N-diethyl-3-hydroxybutanamide.
| Compound Name | (3R)-N,N-diethyl-3-hydroxybutanamide |
|---|---|
| PubChem CID | 11542825 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (3R)-N,N-diethyl-3-hydroxybutanamide |
| SMILES | CCN(CC)C(=O)C[C@@H](C)O |
| InChI | InChI=1S/C8H17NO2/c1-4-9(5-2)8(11)6-7(3)10/h7,10H,4-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | KEMFIWCUWVHWDK-SSDOTTSWSA-N |
| XLogP | 0.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |