C12H12ClN5 — CID 134893777
N'-[(1E)-1-chloro-2,4,4-tricyanobuta-1,3-dienyl]-N,N-diethylmethanimidamide (PubChem CID 134893777) has the molecular formula C12H12ClN5 and a molecular weight of 261.72 g/mol. Its IUPAC name is N'-[(1E)-1-chloro-2,4,4-tricyanobuta-1,3-dienyl]-N,N-diethylmethanimidamide.
| Compound Name | N'-[(1E)-1-chloro-2,4,4-tricyanobuta-1,3-dienyl]-N,N-diethylmethanimidamide |
|---|---|
| PubChem CID | 134893777 |
| Molecular Formula | C12H12ClN5 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N'-[(1E)-1-chloro-2,4,4-tricyanobuta-1,3-dienyl]-N,N-diethylmethanimidamide |
| SMILES | CCN(/C=N/C(Cl)=C(\C#N)C=C(C#N)C#N)CC |
| InChI | InChI=1S/C12H12ClN5/c1-3-18(4-2)9-17-12(13)11(8-16)5-10(6-14)7-15/h5,9H,3-4H2,1-2H3/b12-11-,17-9+ |
| InChIKey | NSMGETWOVYHMDN-WHBUYHIQSA-N |
| XLogP | 2.30 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|