C9H12ClN5O2 — CID 129384856
methyl N-[(Z)-[(E)-3-chloro-2-cyano-3-(dimethylaminomethylideneamino)prop-2-enylidene]amino]carbamate (PubChem CID 129384856) has the molecular formula C9H12ClN5O2 and a molecular weight of 257.68 g/mol. Its IUPAC name is methyl N-[(Z)-[(E)-3-chloro-2-cyano-3-(dimethylaminomethylideneamino)prop-2-enylidene]amino]carbamate.
| Compound Name | methyl N-[(Z)-[(E)-3-chloro-2-cyano-3-(dimethylaminomethylideneamino)prop-2-enylidene]amino]carbamate |
|---|---|
| PubChem CID | 129384856 |
| Molecular Formula | C9H12ClN5O2 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | methyl N-[(Z)-[(E)-3-chloro-2-cyano-3-(dimethylaminomethylideneamino)prop-2-enylidene]amino]carbamate |
| SMILES | COC(=O)N/N=C\C(C#N)=C(/Cl)N=CN(C)C |
| InChI | InChI=1S/C9H12ClN5O2/c1-15(2)6-12-8(10)7(4-11)5-13-14-9(16)17-3/h5-6H,1-3H3,(H,14,16)/b8-7+,12-6?,13-5- |
| InChIKey | CQNJSSNEQXZRQP-BQURNLJJSA-N |
| XLogP | 0.89 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|