C8H11N7 — CID 10703419
N'-[(Z)-1,2-dicyano-2-(hydrazinylmethylideneamino)ethenyl]-N,N-dimethylmethanimidamide (PubChem CID 10703419) has the molecular formula C8H11N7 and a molecular weight of 205.23 g/mol. Its IUPAC name is N'-[(Z)-1,2-dicyano-2-(hydrazinylmethylideneamino)ethenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[(Z)-1,2-dicyano-2-(hydrazinylmethylideneamino)ethenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 10703419 |
| Molecular Formula | C8H11N7 |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N'-[(Z)-1,2-dicyano-2-(hydrazinylmethylideneamino)ethenyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/C(C#N)=C(C#N)\N=C\NN |
| InChI | InChI=1S/C8H11N7/c1-15(2)6-13-8(4-10)7(3-9)12-5-14-11/h5-6H,11H2,1-2H3,(H,12,14)/b8-7-,13-6+ |
| InChIKey | ZOCWWSPYBHQSIF-ZUKYEBQOSA-N |
| XLogP | -0.67 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|