C10H16N4 — CID 56955403
N'-[(E)-1-cyano-2-pyrrolidin-1-ylethenyl]-N,N-dimethylmethanimidamide (PubChem CID 56955403) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is N'-[(E)-1-cyano-2-pyrrolidin-1-ylethenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[(E)-1-cyano-2-pyrrolidin-1-ylethenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 56955403 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N'-[(E)-1-cyano-2-pyrrolidin-1-ylethenyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/C(C#N)=C/N1CCCC1 |
| InChI | InChI=1S/C10H16N4/c1-13(2)9-12-10(7-11)8-14-5-3-4-6-14/h8-9H,3-6H2,1-2H3/b10-8+,12-9+ |
| InChIKey | FRDWQVVUDVYOSX-AXDLQRQNSA-N |
| XLogP | 1.04 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|