C22H28N8O — CID 70677174
N'-[(E)-2-cyano-2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-piperidin-1-ylethenyl]-N,N-dimethylmethanimidamide (PubChem CID 70677174) has the molecular formula C22H28N8O and a molecular weight of 420.52 g/mol. Its IUPAC name is N'-[(E)-2-cyano-2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-piperidin-1-ylethenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[(E)-2-cyano-2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-piperidin-1-ylethenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 70677174 |
| Molecular Formula | C22H28N8O |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N'-[(E)-2-cyano-2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-piperidin-1-ylethenyl]-N,N-dimethylmethanimidamide |
| SMILES | Cc1c(/N=N/C(C#N)=C(/N=C/N(C)C)N2CCCCC2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C22H28N8O/c1-17-20(22(31)30(28(17)4)18-11-7-5-8-12-18)26-25-19(15-23)21(24-16-27(2)3)29-13-9-6-10-14-29/h5,7-8,11-12,16H,6,9-10,13-14H2,1-4H3/b21-19-,24-16+,26-25+ |
| InChIKey | KDKBUMKLCDXEGQ-URHMZMJUSA-N |
| XLogP | 3.34 |
| TPSA | 94.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|