C17H18N4O3S — CID 91526043
methyl 2-cyano-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-methylsulfanylpropanoate (PubChem CID 91526043) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is methyl 2-cyano-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-methylsulfanylpropanoate.
| Compound Name | methyl 2-cyano-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 91526043 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | methyl 2-cyano-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-methylsulfanylpropanoate |
| SMILES | COC(=O)C(C#N)/C(=N/c1c(C)n(C)n(-c2ccccc2)c1=O)SC |
| InChI | InChI=1S/C17H18N4O3S/c1-11-14(19-15(25-4)13(10-18)17(23)24-3)16(22)21(20(11)2)12-8-6-5-7-9-12/h5-9,13H,1-4H3/b19-15- |
| InChIKey | WUJUYPIONVFZRJ-CYVLTUHYSA-N |
| XLogP | 2.19 |
| TPSA | 89.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|