C31H45N3O2Si — CID 66555493
1,5-dimethyl-2-phenyl-4-[1-(2-tributylsilyloxyphenyl)ethylideneamino]pyrazol-3-one (PubChem CID 66555493) has the molecular formula C31H45N3O2Si and a molecular weight of 519.81 g/mol. Its IUPAC name is 1,5-dimethyl-2-phenyl-4-[1-(2-tributylsilyloxyphenyl)ethylideneamino]pyrazol-3-one.
| Compound Name | 1,5-dimethyl-2-phenyl-4-[1-(2-tributylsilyloxyphenyl)ethylideneamino]pyrazol-3-one |
|---|---|
| PubChem CID | 66555493 |
| Molecular Formula | C31H45N3O2Si |
| Molecular Weight | 519.81 g/mol |
| Exact Mass | 519.33 |
| IUPAC Name | 1,5-dimethyl-2-phenyl-4-[1-(2-tributylsilyloxyphenyl)ethylideneamino]pyrazol-3-one |
| SMILES | CCCC[Si](CCCC)(CCCC)Oc1ccccc1/C(C)=N/c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C31H45N3O2Si/c1-7-10-22-37(23-11-8-2,24-12-9-3)36-29-21-17-16-20-28(29)25(4)32-30-26(5)33(6)34(31(30)35)27-18-14-13-15-19-27/h13-21H,7-12,22-24H2,1-6H3/b32-25+ |
| InChIKey | AYJQMXFIVWKVTH-WGPBWIAQSA-N |
| XLogP | 8.35 |
| TPSA | 48.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.81 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|