C20H23N7O2 — CID 3252183
1-[amino-(4-methoxyanilino)methylidene]-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)guanidine (PubChem CID 3252183) has the molecular formula C20H23N7O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 1-[amino-(4-methoxyanilino)methylidene]-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)guanidine.
| Compound Name | 1-[amino-(4-methoxyanilino)methylidene]-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)guanidine |
|---|---|
| PubChem CID | 3252183 |
| Molecular Formula | C20H23N7O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[amino-(4-methoxyanilino)methylidene]-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)guanidine |
| SMILES | COc1ccc(NC(N)=N/C(N)=N/c2c(C)n(C)n(-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C20H23N7O2/c1-13-17(18(28)27(26(13)2)15-7-5-4-6-8-15)24-20(22)25-19(21)23-14-9-11-16(29-3)12-10-14/h4-12H,1-3H3,(H5,21,22,23,24,25) |
| InChIKey | SABYEFFUGTUHNJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|