C16H17N5O2 — CID 21492875
[4-[[amino-[(Z)-[amino(anilino)methylidene]amino]methylidene]amino]phenyl] acetate (PubChem CID 21492875) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is [4-[[amino-[(Z)-[amino(anilino)methylidene]amino]methylidene]amino]phenyl] acetate.
| Compound Name | [4-[[amino-[(Z)-[amino(anilino)methylidene]amino]methylidene]amino]phenyl] acetate |
|---|---|
| PubChem CID | 21492875 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | [4-[[amino-[(Z)-[amino(anilino)methylidene]amino]methylidene]amino]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/N=C(N)/N=C(/N)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C16H17N5O2/c1-11(22)23-14-9-7-13(8-10-14)20-16(18)21-15(17)19-12-5-3-2-4-6-12/h2-10H,1H3,(H5,17,18,19,20,21) |
| InChIKey | DTXDKYAJUYZWSN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|