C12H15N5O2 — CID 137076989
3-oxo-N-[(E)-N'-(N'-phenylcarbamimidoyl)carbamimidoyl]butanamide (PubChem CID 137076989) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is 3-oxo-N-[(E)-N'-(N'-phenylcarbamimidoyl)carbamimidoyl]butanamide.
| Compound Name | 3-oxo-N-[(E)-N'-(N'-phenylcarbamimidoyl)carbamimidoyl]butanamide |
|---|---|
| PubChem CID | 137076989 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-oxo-N-[(E)-N'-(N'-phenylcarbamimidoyl)carbamimidoyl]butanamide |
| SMILES | CC(=O)CC(=O)N/C(N)=N/C(N)=N/c1ccccc1 |
| InChI | InChI=1S/C12H15N5O2/c1-8(18)7-10(19)16-12(14)17-11(13)15-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H5,13,14,15,16,17,19) |
| InChIKey | NQAFCVCKWREZFZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|