C20H18N4O3 — CID 70031436
[3-[[4-(diaminomethylideneamino)phenyl]carbamoyl]naphthalen-2-yl] acetate (PubChem CID 70031436) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is [3-[[4-(diaminomethylideneamino)phenyl]carbamoyl]naphthalen-2-yl] acetate.
| Compound Name | [3-[[4-(diaminomethylideneamino)phenyl]carbamoyl]naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 70031436 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [3-[[4-(diaminomethylideneamino)phenyl]carbamoyl]naphthalen-2-yl] acetate |
| SMILES | CC(=O)Oc1cc2ccccc2cc1C(=O)Nc1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C20H18N4O3/c1-12(25)27-18-11-14-5-3-2-4-13(14)10-17(18)19(26)23-15-6-8-16(9-7-15)24-20(21)22/h2-11H,1H3,(H,23,26)(H4,21,22,24) |
| InChIKey | VYAATWOISARDAT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|