C14H13ClN6 — CID 10756669
N'-[(Z)-2-[(4-chloroanilino)methylideneamino]-1,2-dicyanoethenyl]-N,N-dimethylmethanimidamide (PubChem CID 10756669) has the molecular formula C14H13ClN6 and a molecular weight of 300.75 g/mol. Its IUPAC name is N'-[(Z)-2-[(4-chloroanilino)methylideneamino]-1,2-dicyanoethenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[(Z)-2-[(4-chloroanilino)methylideneamino]-1,2-dicyanoethenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 10756669 |
| Molecular Formula | C14H13ClN6 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N'-[(Z)-2-[(4-chloroanilino)methylideneamino]-1,2-dicyanoethenyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/C(C#N)=C(C#N)\N=C\Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H13ClN6/c1-21(2)10-20-14(8-17)13(7-16)19-9-18-12-5-3-11(15)4-6-12/h3-6,9-10H,1-2H3,(H,18,19)/b14-13-,20-10+ |
| InChIKey | JALFHDRIDHHUIH-OUTKMQMGSA-N |
| XLogP | 2.63 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|