C10H6N8 — CID 5466521
(Z)-2-amino-3-[2-[(Z)-2-amino-1,2-dicyanoethenyl]iminoethylideneamino]but-2-enedinitrile (PubChem CID 5466521) has the molecular formula C10H6N8 and a molecular weight of 238.21 g/mol. Its IUPAC name is (Z)-2-amino-3-[2-[(Z)-2-amino-1,2-dicyanoethenyl]iminoethylideneamino]but-2-enedinitrile.
| Compound Name | (Z)-2-amino-3-[2-[(Z)-2-amino-1,2-dicyanoethenyl]iminoethylideneamino]but-2-enedinitrile |
|---|---|
| PubChem CID | 5466521 |
| Molecular Formula | C10H6N8 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (Z)-2-amino-3-[2-[(Z)-2-amino-1,2-dicyanoethenyl]iminoethylideneamino]but-2-enedinitrile |
| SMILES | N#C/C(N)=C(C#N)/N=C/C=N/C(C#N)=C(\N)C#N |
| InChI | InChI=1S/C10H6N8/c11-3-7(15)9(5-13)17-1-2-18-10(6-14)8(16)4-12/h1-2H,15-16H2/b9-7-,10-8-,17-1+,18-2+ |
| InChIKey | NSAPBOHMSIOQID-IFRPRURQSA-N |
| XLogP | -0.44 |
| TPSA | 171.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|