C5H5N5 — CID 3005068
N'-[(E)-2-amino-1,2-dicyanoethenyl]methanimidamide (PubChem CID 3005068) has the molecular formula C5H5N5 and a molecular weight of 135.13 g/mol. Its IUPAC name is N'-[(E)-2-amino-1,2-dicyanoethenyl]methanimidamide.
| Compound Name | N'-[(E)-2-amino-1,2-dicyanoethenyl]methanimidamide |
|---|---|
| PubChem CID | 3005068 |
| Molecular Formula | C5H5N5 |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | N'-[(E)-2-amino-1,2-dicyanoethenyl]methanimidamide |
| SMILES | N#C/C(N)=C(C#N)\N=C\N |
| InChI | InChI=1S/C5H5N5/c6-1-4(9)5(2-7)10-3-8/h3H,9H2,(H2,8,10)/b5-4+ |
| InChIKey | JOWVYROMILUUHH-SNAWJCMRSA-N |
| XLogP | -0.81 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|