C5H4N4 — CID 173463412
N'-(1,2-dicyanoethenyl)methanimidamide (PubChem CID 173463412) has the molecular formula C5H4N4 and a molecular weight of 120.11 g/mol. Its IUPAC name is N'-(1,2-dicyanoethenyl)methanimidamide.
| Compound Name | N'-(1,2-dicyanoethenyl)methanimidamide |
|---|---|
| PubChem CID | 173463412 |
| Molecular Formula | C5H4N4 |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | N'-(1,2-dicyanoethenyl)methanimidamide |
| SMILES | N#CC=C(C#N)/N=C/N |
| InChI | InChI=1S/C5H4N4/c6-2-1-5(3-7)9-4-8/h1,4H,(H2,8,9) |
| InChIKey | FOEWLEWMZCSLGY-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|