C6H9IN2 — CID 90337312
N'-[(3Z)-5-iodopenta-1,3-dien-2-yl]methanimidamide (PubChem CID 90337312) has the molecular formula C6H9IN2 and a molecular weight of 236.06 g/mol. Its IUPAC name is N'-[(3Z)-5-iodopenta-1,3-dien-2-yl]methanimidamide.
| Compound Name | N'-[(3Z)-5-iodopenta-1,3-dien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 90337312 |
| Molecular Formula | C6H9IN2 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | N'-[(3Z)-5-iodopenta-1,3-dien-2-yl]methanimidamide |
| SMILES | C=C(/C=C\CI)/N=C/N |
| InChI | InChI=1S/C6H9IN2/c1-6(9-5-8)3-2-4-7/h2-3,5H,1,4H2,(H2,8,9)/b3-2- |
| InChIKey | GWYJHOMGBFQHEE-IHWYPQMZSA-N |
| XLogP | 1.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|