C13H10N4S2 — CID 2820725
(Z)-2-amino-3-[(3,4-dimethylthieno[2,3-b]thiophen-5-yl)methylideneamino]but-2-enedinitrile (PubChem CID 2820725) has the molecular formula C13H10N4S2 and a molecular weight of 286.39 g/mol. Its IUPAC name is (Z)-2-amino-3-[(3,4-dimethylthieno[2,3-b]thiophen-5-yl)methylideneamino]but-2-enedinitrile.
| Compound Name | (Z)-2-amino-3-[(3,4-dimethylthieno[2,3-b]thiophen-5-yl)methylideneamino]but-2-enedinitrile |
|---|---|
| PubChem CID | 2820725 |
| Molecular Formula | C13H10N4S2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | (Z)-2-amino-3-[(3,4-dimethylthieno[2,3-b]thiophen-5-yl)methylideneamino]but-2-enedinitrile |
| SMILES | Cc1csc2sc(/C=N/C(C#N)=C(\N)C#N)c(C)c12 |
| InChI | InChI=1S/C13H10N4S2/c1-7-6-18-13-12(7)8(2)11(19-13)5-17-10(4-15)9(16)3-14/h5-6H,16H2,1-2H3/b10-9-,17-5+ |
| InChIKey | GXEZRGOLBHWVJQ-SYSGVOERSA-N |
| XLogP | 3.22 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|