C13H13N5O2 — CID 3450699
N'-(2-amino-1,2-dicyanoethenyl)-N-(2,5-dimethoxyphenyl)methanimidamide (PubChem CID 3450699) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is N'-(2-amino-1,2-dicyanoethenyl)-N-(2,5-dimethoxyphenyl)methanimidamide.
| Compound Name | N'-(2-amino-1,2-dicyanoethenyl)-N-(2,5-dimethoxyphenyl)methanimidamide |
|---|---|
| PubChem CID | 3450699 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N'-(2-amino-1,2-dicyanoethenyl)-N-(2,5-dimethoxyphenyl)methanimidamide |
| SMILES | COc1ccc(OC)c(N/C=N/C(C#N)=C(N)C#N)c1 |
| InChI | InChI=1S/C13H13N5O2/c1-19-9-3-4-13(20-2)11(5-9)17-8-18-12(7-15)10(16)6-14/h3-5,8H,16H2,1-2H3,(H,17,18) |
| InChIKey | VMYGCMRPJQBHBP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|