C9H10N2O2 — CID 54806316
(2,5-dimethoxyphenyl)cyanamide (PubChem CID 54806316) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)cyanamide.
| Compound Name | (2,5-dimethoxyphenyl)cyanamide |
|---|---|
| PubChem CID | 54806316 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (2,5-dimethoxyphenyl)cyanamide |
| SMILES | COc1ccc(OC)c(NC#N)c1 |
| InChI | InChI=1S/C9H10N2O2/c1-12-7-3-4-9(13-2)8(5-7)11-6-10/h3-5,11H,1-2H3 |
| InChIKey | KMOMLDBVKXWRPA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|