methyl 2-(2,5-dimethoxyanilino)propanoate

C12H17NO4 — CID 54941046

IUPACmethyl 2-(2,5-dimethoxyanilino)propanoate
SMILESCOC(=O)C(C)Nc1cc(OC)ccc1OC
InChIInChI=1S/C12H17NO4/c1-8(12(14)17-4)13-10-7-9(15-2)5-6-11(10)16-3/h5-8,13H,1-4H3
InChIKeyWUYBHGWCIHLXAT-UHFFFAOYSA-N
MW239.27 g/mol
LogP1.68
Rot. Bonds5

About methyl 2-(2,5-dimethoxyanilino)propanoate

methyl 2-(2,5-dimethoxyanilino)propanoate (PubChem CID 54941046) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is methyl 2-(2,5-dimethoxyanilino)propanoate.

Molecular Properties

Compound Namemethyl 2-(2,5-dimethoxyanilino)propanoate
PubChem CID54941046
Molecular FormulaC12H17NO4
Molecular Weight239.27 g/mol
Exact Mass239.12
IUPAC Namemethyl 2-(2,5-dimethoxyanilino)propanoate
SMILESCOC(=O)C(C)Nc1cc(OC)ccc1OC
InChIInChI=1S/C12H17NO4/c1-8(12(14)17-4)13-10-7-9(15-2)5-6-11(10)16-3/h5-8,13H,1-4H3
InChIKeyWUYBHGWCIHLXAT-UHFFFAOYSA-N
XLogP1.68
TPSA56.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.27
LogP ≤ 51.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-(2,5-dimethoxyanilino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,5-dimethoxyanilino)propanoate?
The IUPAC name of methyl 2-(2,5-dimethoxyanilino)propanoate (CID 54941046) is methyl 2-(2,5-dimethoxyanilino)propanoate.
What is the SMILES notation for methyl 2-(2,5-dimethoxyanilino)propanoate?
The canonical SMILES for methyl 2-(2,5-dimethoxyanilino)propanoate is COC(=O)C(C)Nc1cc(OC)ccc1OC.
What is the InChIKey of methyl 2-(2,5-dimethoxyanilino)propanoate?
The InChIKey is WUYBHGWCIHLXAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4/c1-8(12(14)17-4)13-10-7-9(15-2)5-6-11(10)16-3/h5-8,13H,1-4H3.
What are the key properties of methyl 2-(2,5-dimethoxyanilino)propanoate?
methyl 2-(2,5-dimethoxyanilino)propanoate has a molecular weight of 239.27 g/mol, XLogP of 1.68, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,5-dimethoxyanilino)propanoate is sourced from PubChem (CID 54941046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).