C11H10O2S2 — CID 2778913
3-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)prop-2-enoic acid (PubChem CID 2778913) has the molecular formula C11H10O2S2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)prop-2-enoic acid.
| Compound Name | 3-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 2778913 |
| Molecular Formula | C11H10O2S2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 3-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)prop-2-enoic acid |
| SMILES | Cc1csc2sc(C=CC(=O)O)c(C)c12 |
| InChI | InChI=1S/C11H10O2S2/c1-6-5-14-11-10(6)7(2)8(15-11)3-4-9(12)13/h3-5H,1-2H3,(H,12,13) |
| InChIKey | WXHZXFSXZUISRX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|