C7H6ClNO3S — CID 130580216
(E)-3-(4-chloro-2-methoxy-1,3-thiazol-5-yl)prop-2-enoic acid (PubChem CID 130580216) has the molecular formula C7H6ClNO3S and a molecular weight of 219.65 g/mol. Its IUPAC name is (E)-3-(4-chloro-2-methoxy-1,3-thiazol-5-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(4-chloro-2-methoxy-1,3-thiazol-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 130580216 |
| Molecular Formula | C7H6ClNO3S |
| Molecular Weight | 219.65 g/mol |
| Exact Mass | 218.98 |
| IUPAC Name | (E)-3-(4-chloro-2-methoxy-1,3-thiazol-5-yl)prop-2-enoic acid |
| SMILES | COc1nc(Cl)c(/C=C/C(=O)O)s1 |
| InChI | InChI=1S/C7H6ClNO3S/c1-12-7-9-6(8)4(13-7)2-3-5(10)11/h2-3H,1H3,(H,10,11)/b3-2+ |
| InChIKey | KFIBUKWFNFHJDZ-NSCUHMNNSA-N |
| XLogP | 1.90 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.65 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|