C12H24N3O3P — CID 5324044
N'-(1-cyano-1-diethoxyphosphorylethyl)-N,N-diethylmethanimidamide (PubChem CID 5324044) has the molecular formula C12H24N3O3P and a molecular weight of 289.32 g/mol. Its IUPAC name is N'-(1-cyano-1-diethoxyphosphorylethyl)-N,N-diethylmethanimidamide.
| Compound Name | N'-(1-cyano-1-diethoxyphosphorylethyl)-N,N-diethylmethanimidamide |
|---|---|
| PubChem CID | 5324044 |
| Molecular Formula | C12H24N3O3P |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N'-(1-cyano-1-diethoxyphosphorylethyl)-N,N-diethylmethanimidamide |
| SMILES | CCOP(=O)(OCC)C(C)(C#N)N=CN(CC)CC |
| InChI | InChI=1S/C12H24N3O3P/c1-6-15(7-2)11-14-12(5,10-13)19(16,17-8-3)18-9-4/h11H,6-9H2,1-5H3 |
| InChIKey | VLTPSKRKCXKGRD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|