C9H13F3NO4P — CID 100960610
2-diethoxyphosphoryl-4,4,4-trifluoro-2-methyl-3-oxobutanenitrile (PubChem CID 100960610) has the molecular formula C9H13F3NO4P and a molecular weight of 287.17 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-4,4,4-trifluoro-2-methyl-3-oxobutanenitrile.
| Compound Name | 2-diethoxyphosphoryl-4,4,4-trifluoro-2-methyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 100960610 |
| Molecular Formula | C9H13F3NO4P |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-diethoxyphosphoryl-4,4,4-trifluoro-2-methyl-3-oxobutanenitrile |
| SMILES | CCOP(=O)(OCC)C(C)(C#N)C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H13F3NO4P/c1-4-16-18(15,17-5-2)8(3,6-13)7(14)9(10,11)12/h4-5H2,1-3H3 |
| InChIKey | XCAQJGZSKZGWBR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|