C15H28N2O6P2 — CID 15811799
4,4-bis(diethoxyphosphoryl)heptanedinitrile (PubChem CID 15811799) has the molecular formula C15H28N2O6P2 and a molecular weight of 394.35 g/mol. Its IUPAC name is 4,4-bis(diethoxyphosphoryl)heptanedinitrile.
| Compound Name | 4,4-bis(diethoxyphosphoryl)heptanedinitrile |
|---|---|
| PubChem CID | 15811799 |
| Molecular Formula | C15H28N2O6P2 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 4,4-bis(diethoxyphosphoryl)heptanedinitrile |
| SMILES | CCOP(=O)(OCC)C(CCC#N)(CCC#N)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H28N2O6P2/c1-5-20-24(18,21-6-2)15(11-9-13-16,12-10-14-17)25(19,22-7-3)23-8-4/h5-12H2,1-4H3 |
| InChIKey | FXPNVQJCJIRBRP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|