About diethoxyphosphorylformonitrile;methanediimine;hydrochloride
diethoxyphosphorylformonitrile;methanediimine;hydrochloride (PubChem CID 155345866) has the molecular formula C6H13ClN3O3P
and a molecular weight of 241.61 g/mol. Its IUPAC name is diethoxyphosphorylformonitrile;methanediimine;hydrochloride.
Molecular Properties
| Compound Name | diethoxyphosphorylformonitrile;methanediimine;hydrochloride |
| PubChem CID | 155345866 |
| Molecular Formula | C6H13ClN3O3P |
| Molecular Weight | 241.61 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | diethoxyphosphorylformonitrile;methanediimine;hydrochloride |
| SMILES | CCOP(=O)(C#N)OCC.Cl.N=C=N |
| InChI | InChI=1S/C5H10NO3P.CH2N2.ClH/c1-3-8-10(7,5-6)9-4-2;2-1-3;/h3-4H2,1-2H3;2-3H;1H |
| InChIKey | ZGSAAISQYCEFJF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxyphosphorylformonitrile;methanediimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxyphosphorylformonitrile;methanediimine;hydrochloride?
The IUPAC name of diethoxyphosphorylformonitrile;methanediimine;hydrochloride (CID 155345866) is diethoxyphosphorylformonitrile;methanediimine;hydrochloride.
What is the SMILES notation for diethoxyphosphorylformonitrile;methanediimine;hydrochloride?
The canonical SMILES for diethoxyphosphorylformonitrile;methanediimine;hydrochloride is CCOP(=O)(C#N)OCC.Cl.N=C=N.
What is the InChIKey of diethoxyphosphorylformonitrile;methanediimine;hydrochloride?
The InChIKey is ZGSAAISQYCEFJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO3P.CH2N2.ClH/c1-3-8-10(7,5-6)9-4-2;2-1-3;/h3-4H2,1-2H3;2-3H;1H.
What are the key properties of diethoxyphosphorylformonitrile;methanediimine;hydrochloride?
diethoxyphosphorylformonitrile;methanediimine;hydrochloride has a molecular weight of 241.61 g/mol, XLogP of 2.47, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxyphosphorylformonitrile;methanediimine;hydrochloride is sourced from PubChem (CID 155345866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).